ChemNet > CAS > 249278-33-9 3-[2,3-Di(benzyloxy)phenyl]propanenitril
249278-33-9 3-[2,3-Di(benzyloxy)phenyl]propanenitril
| Produkt-Name |
3-[2,3-Di(benzyloxy)phenyl]propanenitril |
| Synonyme |
3-[2,3-Bis(benzyloxy)phenyl]propanenitril |
| Englischer Name |
3-[2,3-di(benzyloxy)phenyl]propanenitrile;3-[2,3-bis(benzyloxy)phenyl]propanenitrile |
| Molekulare Formel |
C23H21NO2 |
| Molecular Weight |
343.4183 |
| InChI |
InChI=1/C23H21NO2/c24-16-8-14-21-13-7-15-22(25-17-19-9-3-1-4-10-19)23(21)26-18-20-11-5-2-6-12-20/h1-7,9-13,15H,8,14,17-18H2 |
| CAS Registry Number |
249278-33-9 |
| Molecular Structure |
|
| Dichte |
1.138g/cm3 |
| Schmelzpunkt |
200℃ |
| Siedepunkt |
525.9°C at 760 mmHg |
| Brechungsindex |
1.596 |
| Flammpunkt |
174.5°C |
| Dampfdruck |
3.75E-11mmHg at 25°C |
| Gefahrensymbole |
Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
|
|